C7H7B2FO6 — CID 156770264
2,3-diborono-4-fluorobenzoic acid (PubChem CID 156770264) has the molecular formula C7H7B2FO6 and a molecular weight of 227.75 g/mol. Its IUPAC name is 2,3-diborono-4-fluorobenzoic acid.
| Compound Name | 2,3-diborono-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 156770264 |
| Molecular Formula | C7H7B2FO6 |
| Molecular Weight | 227.75 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 2,3-diborono-4-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(B(O)O)c1B(O)O |
| InChI | InChI=1S/C7H7B2FO6/c10-4-2-1-3(7(11)12)5(8(13)14)6(4)9(15)16/h1-2,13-16H,(H,11,12) |
| InChIKey | HKJTWZBBSCVTNM-UHFFFAOYSA-N |
| XLogP | -3.12 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.75 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|