C10H16N2 — CID 156859334
ethane;8-methyl-5,6-dihydroimidazo[1,2-a]pyridine (PubChem CID 156859334) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is ethane;8-methyl-5,6-dihydroimidazo[1,2-a]pyridine.
| Compound Name | ethane;8-methyl-5,6-dihydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 156859334 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | ethane;8-methyl-5,6-dihydroimidazo[1,2-a]pyridine |
| SMILES | CC.CC1=CCCn2ccnc21 |
| InChI | InChI=1S/C8H10N2.C2H6/c1-7-3-2-5-10-6-4-9-8(7)10;1-2/h3-4,6H,2,5H2,1H3;1-2H3 |
| InChIKey | VIUSZBVZWCNUDK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |