About ethane;2-ethyl-7-pent-2-ynyl-2,7-diazaspiro[3.5]nonane
ethane;2-ethyl-7-pent-2-ynyl-2,7-diazaspiro[3.5]nonane (PubChem CID 156860387) has the molecular formula C16H30N2
and a molecular weight of 250.43 g/mol. Its IUPAC name is ethane;2-ethyl-7-pent-2-ynyl-2,7-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | ethane;2-ethyl-7-pent-2-ynyl-2,7-diazaspiro[3.5]nonane |
| PubChem CID | 156860387 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | ethane;2-ethyl-7-pent-2-ynyl-2,7-diazaspiro[3.5]nonane |
| SMILES | CC.CCC#CCN1CCC2(CC1)CN(CC)C2 |
| InChI | InChI=1S/C14H24N2.C2H6/c1-3-5-6-9-16-10-7-14(8-11-16)12-15(4-2)13-14;1-2/h3-4,7-13H2,1-2H3;1-2H3 |
| InChIKey | UGOPRNMLUXUWQL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-ethyl-7-pent-2-ynyl-2,7-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-7-pent-2-ynyl-2,7-diazaspiro[3.5]nonane?
The IUPAC name of ethane;2-ethyl-7-pent-2-ynyl-2,7-diazaspiro[3.5]nonane (CID 156860387) is ethane;2-ethyl-7-pent-2-ynyl-2,7-diazaspiro[3.5]nonane.
What is the SMILES notation for ethane;2-ethyl-7-pent-2-ynyl-2,7-diazaspiro[3.5]nonane?
The canonical SMILES for ethane;2-ethyl-7-pent-2-ynyl-2,7-diazaspiro[3.5]nonane is CC.CCC#CCN1CCC2(CC1)CN(CC)C2.
What is the InChIKey of ethane;2-ethyl-7-pent-2-ynyl-2,7-diazaspiro[3.5]nonane?
The InChIKey is UGOPRNMLUXUWQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2.C2H6/c1-3-5-6-9-16-10-7-14(8-11-16)12-15(4-2)13-14;1-2/h3-4,7-13H2,1-2H3;1-2H3.
What are the key properties of ethane;2-ethyl-7-pent-2-ynyl-2,7-diazaspiro[3.5]nonane?
ethane;2-ethyl-7-pent-2-ynyl-2,7-diazaspiro[3.5]nonane has a molecular weight of 250.43 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-7-pent-2-ynyl-2,7-diazaspiro[3.5]nonane is sourced from PubChem (CID 156860387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).