C39H49FN5OP — CID 156874160
4-[4-[10-[fluoro(triphenyl)-λ5-phosphanyl]decoxy]phenyl]-6-N,6-N-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine (PubChem CID 156874160) has the molecular formula C39H49FN5OP and a molecular weight of 653.83 g/mol. Its IUPAC name is 4-[4-[10-[fluoro(triphenyl)-λ5-phosphanyl]decoxy]phenyl]-6-N,6-N-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine.
| Compound Name | 4-[4-[10-[fluoro(triphenyl)-λ5-phosphanyl]decoxy]phenyl]-6-N,6-N-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
|---|---|
| PubChem CID | 156874160 |
| Molecular Formula | C39H49FN5OP |
| Molecular Weight | 653.83 g/mol |
| Exact Mass | 653.37 |
| IUPAC Name | 4-[4-[10-[fluoro(triphenyl)-λ5-phosphanyl]decoxy]phenyl]-6-N,6-N-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
| SMILES | CN(C)C1=NC(c2ccc(OCCCCCCCCCCP(F)(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)N=C(N)N1 |
| InChI | InChI=1S/C39H49FN5OP/c1-45(2)39-43-37(42-38(41)44-39)32-26-28-33(29-27-32)46-30-18-7-5-3-4-6-8-19-31-47(40,34-20-12-9-13-21-34,35-22-14-10-15-23-35)36-24-16-11-17-25-36/h9-17,20-29,37H,3-8,18-19,30-31H2,1-2H3,(H3,41,42,43,44) |
| InChIKey | DPSVERKIFGAINY-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.83 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|