C33H38ClIN5OP — CID 156874105
[4-amino-2-[4-[4-[iodo(triphenyl)-λ5-phosphanyl]butoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-dimethylazanium chloride (PubChem CID 156874105) has the molecular formula C33H38ClIN5OP and a molecular weight of 714.03 g/mol. Its IUPAC name is [4-amino-2-[4-[4-[iodo(triphenyl)-λ5-phosphanyl]butoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-dimethylazanium chloride.
| Compound Name | [4-amino-2-[4-[4-[iodo(triphenyl)-λ5-phosphanyl]butoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-dimethylazanium chloride |
|---|---|
| PubChem CID | 156874105 |
| Molecular Formula | C33H38ClIN5OP |
| Molecular Weight | 714.03 g/mol |
| Exact Mass | 713.15 |
| IUPAC Name | [4-amino-2-[4-[4-[iodo(triphenyl)-λ5-phosphanyl]butoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-dimethylazanium chloride |
| SMILES | C[N+](C)=C1NC(N)=NC(c2ccc(OCCCCP(I)(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)N1.[Cl-] |
| InChI | InChI=1S/C33H37IN5OP.ClH/c1-39(2)33-37-31(36-32(35)38-33)26-20-22-27(23-21-26)40-24-12-13-25-41(34,28-14-6-3-7-15-28,29-16-8-4-9-17-29)30-18-10-5-11-19-30;/h3-11,14-23,31H,12-13,24-25H2,1-2H3,(H3,35,36,37,38);1H |
| InChIKey | LHTGMSBRMNZDAY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.03 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|