C36H44ClIN5OP — CID 156874188
[4-amino-2-[4-[7-[iodo(triphenyl)-λ5-phosphanyl]heptoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-dimethylazanium chloride (PubChem CID 156874188) has the molecular formula C36H44ClIN5OP and a molecular weight of 756.11 g/mol. Its IUPAC name is [4-amino-2-[4-[7-[iodo(triphenyl)-λ5-phosphanyl]heptoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-dimethylazanium chloride.
| Compound Name | [4-amino-2-[4-[7-[iodo(triphenyl)-λ5-phosphanyl]heptoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-dimethylazanium chloride |
|---|---|
| PubChem CID | 156874188 |
| Molecular Formula | C36H44ClIN5OP |
| Molecular Weight | 756.11 g/mol |
| Exact Mass | 755.20 |
| IUPAC Name | [4-amino-2-[4-[7-[iodo(triphenyl)-λ5-phosphanyl]heptoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-dimethylazanium chloride |
| SMILES | C[N+](C)=C1NC(N)=NC(c2ccc(OCCCCCCCP(I)(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)N1.[Cl-] |
| InChI | InChI=1S/C36H43IN5OP.ClH/c1-42(2)36-40-34(39-35(38)41-36)29-23-25-30(26-24-29)43-27-15-4-3-5-16-28-44(37,31-17-9-6-10-18-31,32-19-11-7-12-20-32)33-21-13-8-14-22-33;/h6-14,17-26,34H,3-5,15-16,27-28H2,1-2H3,(H3,38,39,40,41);1H |
| InChIKey | DZWSYZRZEPDASU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.11 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|