C32H36BrClN5OP — CID 156874289
[4-amino-2-[4-[3-[chloro(triphenyl)-λ5-phosphanyl]propoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-dimethylazanium bromide (PubChem CID 156874289) has the molecular formula C32H36BrClN5OP and a molecular weight of 653.01 g/mol. Its IUPAC name is [4-amino-2-[4-[3-[chloro(triphenyl)-λ5-phosphanyl]propoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-dimethylazanium bromide.
| Compound Name | [4-amino-2-[4-[3-[chloro(triphenyl)-λ5-phosphanyl]propoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-dimethylazanium bromide |
|---|---|
| PubChem CID | 156874289 |
| Molecular Formula | C32H36BrClN5OP |
| Molecular Weight | 653.01 g/mol |
| Exact Mass | 651.15 |
| IUPAC Name | [4-amino-2-[4-[3-[chloro(triphenyl)-λ5-phosphanyl]propoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-dimethylazanium bromide |
| SMILES | C[N+](C)=C1NC(N)=NC(c2ccc(OCCCP(Cl)(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)N1.[Br-] |
| InChI | InChI=1S/C32H35ClN5OP.BrH/c1-38(2)32-36-30(35-31(34)37-32)25-19-21-26(22-20-25)39-23-12-24-40(33,27-13-6-3-7-14-27,28-15-8-4-9-16-28)29-17-10-5-11-18-29;/h3-11,13-22,30H,12,23-24H2,1-2H3,(H3,34,35,36,37);1H |
| InChIKey | MPCQDPNMJKOBHP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.01 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|