C33H38BrClN5OP — CID 156874218
4-[4-[4-[bromo(triphenyl)-λ5-phosphanyl]butoxy]phenyl]-6-N,6-N-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine;hydrochloride (PubChem CID 156874218) has the molecular formula C33H38BrClN5OP and a molecular weight of 667.03 g/mol. Its IUPAC name is 4-[4-[4-[bromo(triphenyl)-λ5-phosphanyl]butoxy]phenyl]-6-N,6-N-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine;hydrochloride.
| Compound Name | 4-[4-[4-[bromo(triphenyl)-λ5-phosphanyl]butoxy]phenyl]-6-N,6-N-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 156874218 |
| Molecular Formula | C33H38BrClN5OP |
| Molecular Weight | 667.03 g/mol |
| Exact Mass | 665.17 |
| IUPAC Name | 4-[4-[4-[bromo(triphenyl)-λ5-phosphanyl]butoxy]phenyl]-6-N,6-N-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine;hydrochloride |
| SMILES | CN(C)C1=NC(c2ccc(OCCCCP(Br)(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)N=C(N)N1.Cl |
| InChI | InChI=1S/C33H37BrN5OP.ClH/c1-39(2)33-37-31(36-32(35)38-33)26-20-22-27(23-21-26)40-24-12-13-25-41(34,28-14-6-3-7-15-28,29-16-8-4-9-17-29)30-18-10-5-11-19-30;/h3-11,14-23,31H,12-13,24-25H2,1-2H3,(H3,35,36,37,38);1H |
| InChIKey | UUTHZLVWBJZGNT-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.03 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|