C40H43BrN5OP — CID 156874200
2-[4-[5-[bromo(triphenyl)-λ5-phosphanyl]pentoxy]phenyl]-6-(2-phenylethylimino)-2,5-dihydro-1H-1,3,5-triazin-4-amine (PubChem CID 156874200) has the molecular formula C40H43BrN5OP and a molecular weight of 720.70 g/mol. Its IUPAC name is 2-[4-[5-[bromo(triphenyl)-λ5-phosphanyl]pentoxy]phenyl]-6-(2-phenylethylimino)-2,5-dihydro-1H-1,3,5-triazin-4-amine.
| Compound Name | 2-[4-[5-[bromo(triphenyl)-λ5-phosphanyl]pentoxy]phenyl]-6-(2-phenylethylimino)-2,5-dihydro-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 156874200 |
| Molecular Formula | C40H43BrN5OP |
| Molecular Weight | 720.70 g/mol |
| Exact Mass | 719.24 |
| IUPAC Name | 2-[4-[5-[bromo(triphenyl)-λ5-phosphanyl]pentoxy]phenyl]-6-(2-phenylethylimino)-2,5-dihydro-1H-1,3,5-triazin-4-amine |
| SMILES | NC1=NC(c2ccc(OCCCCCP(Br)(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)N/C(=N/CCc2ccccc2)N1 |
| InChI | InChI=1S/C40H43BrN5OP/c41-48(35-18-8-2-9-19-35,36-20-10-3-11-21-36,37-22-12-4-13-23-37)31-15-5-14-30-47-34-26-24-33(25-27-34)38-44-39(42)46-40(45-38)43-29-28-32-16-6-1-7-17-32/h1-4,6-13,16-27,38H,5,14-15,28-31H2,(H4,42,43,44,45,46) |
| InChIKey | ZAJOKYGIARPERY-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 84.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.70 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|