C41H46Cl2N5OP — CID 156874273
[4-amino-2-[4-[6-[chloro(triphenyl)-λ5-phosphanyl]hexoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-(2-phenylethyl)azanium chloride (PubChem CID 156874273) has the molecular formula C41H46Cl2N5OP and a molecular weight of 726.73 g/mol. Its IUPAC name is [4-amino-2-[4-[6-[chloro(triphenyl)-λ5-phosphanyl]hexoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-(2-phenylethyl)azanium chloride.
| Compound Name | [4-amino-2-[4-[6-[chloro(triphenyl)-λ5-phosphanyl]hexoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-(2-phenylethyl)azanium chloride |
|---|---|
| PubChem CID | 156874273 |
| Molecular Formula | C41H46Cl2N5OP |
| Molecular Weight | 726.73 g/mol |
| Exact Mass | 725.28 |
| IUPAC Name | [4-amino-2-[4-[6-[chloro(triphenyl)-λ5-phosphanyl]hexoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-(2-phenylethyl)azanium chloride |
| SMILES | NC1=NC(c2ccc(OCCCCCCP(Cl)(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)N/C(=[NH+]/CCc2ccccc2)N1.[Cl-] |
| InChI | InChI=1S/C41H45ClN5OP.ClH/c42-49(36-19-9-4-10-20-36,37-21-11-5-12-22-37,38-23-13-6-14-24-38)32-16-2-1-15-31-48-35-27-25-34(26-28-35)39-45-40(43)47-41(46-39)44-30-29-33-17-7-3-8-18-33;/h3-14,17-28,39H,1-2,15-16,29-32H2,(H4,43,44,45,46,47);1H |
| InChIKey | CQECDKHFVZIMAN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 85.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.73 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|