C42H48BrClN5OP — CID 156874329
2-[4-[7-[bromo(triphenyl)-λ5-phosphanyl]heptoxy]phenyl]-6-(2-phenylethylimino)-2,5-dihydro-1H-1,3,5-triazin-4-amine;hydrochloride (PubChem CID 156874329) has the molecular formula C42H48BrClN5OP and a molecular weight of 785.21 g/mol. Its IUPAC name is 2-[4-[7-[bromo(triphenyl)-λ5-phosphanyl]heptoxy]phenyl]-6-(2-phenylethylimino)-2,5-dihydro-1H-1,3,5-triazin-4-amine;hydrochloride.
| Compound Name | 2-[4-[7-[bromo(triphenyl)-λ5-phosphanyl]heptoxy]phenyl]-6-(2-phenylethylimino)-2,5-dihydro-1H-1,3,5-triazin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 156874329 |
| Molecular Formula | C42H48BrClN5OP |
| Molecular Weight | 785.21 g/mol |
| Exact Mass | 783.25 |
| IUPAC Name | 2-[4-[7-[bromo(triphenyl)-λ5-phosphanyl]heptoxy]phenyl]-6-(2-phenylethylimino)-2,5-dihydro-1H-1,3,5-triazin-4-amine;hydrochloride |
| SMILES | Cl.NC1=NC(c2ccc(OCCCCCCCP(Br)(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)N/C(=N/CCc2ccccc2)N1 |
| InChI | InChI=1S/C42H47BrN5OP.ClH/c43-50(37-20-10-5-11-21-37,38-22-12-6-13-23-38,39-24-14-7-15-25-39)33-17-3-1-2-16-32-49-36-28-26-35(27-29-36)40-46-41(44)48-42(47-40)45-31-30-34-18-8-4-9-19-34;/h4-15,18-29,40H,1-3,16-17,30-33H2,(H4,44,45,46,47,48);1H |
| InChIKey | PJSZZZIWNDBVGR-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 84.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.21 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|