C34H40Cl2N5OP — CID 156874250
[4-amino-2-[4-[5-[chloro(triphenyl)-λ5-phosphanyl]pentoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-dimethylazanium chloride (PubChem CID 156874250) has the molecular formula C34H40Cl2N5OP and a molecular weight of 636.61 g/mol. Its IUPAC name is [4-amino-2-[4-[5-[chloro(triphenyl)-λ5-phosphanyl]pentoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-dimethylazanium chloride.
| Compound Name | [4-amino-2-[4-[5-[chloro(triphenyl)-λ5-phosphanyl]pentoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-dimethylazanium chloride |
|---|---|
| PubChem CID | 156874250 |
| Molecular Formula | C34H40Cl2N5OP |
| Molecular Weight | 636.61 g/mol |
| Exact Mass | 635.23 |
| IUPAC Name | [4-amino-2-[4-[5-[chloro(triphenyl)-λ5-phosphanyl]pentoxy]phenyl]-2,5-dihydro-1H-1,3,5-triazin-6-ylidene]-dimethylazanium chloride |
| SMILES | C[N+](C)=C1NC(N)=NC(c2ccc(OCCCCCP(Cl)(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)N1.[Cl-] |
| InChI | InChI=1S/C34H39ClN5OP.ClH/c1-40(2)34-38-32(37-33(36)39-34)27-21-23-28(24-22-27)41-25-13-6-14-26-42(35,29-15-7-3-8-16-29,30-17-9-4-10-18-30)31-19-11-5-12-20-31;/h3-5,7-12,15-24,32H,6,13-14,25-26H2,1-2H3,(H3,36,37,38,39);1H |
| InChIKey | BQIANCJOERYRIA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.61 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|