C34H39BrN5OP — CID 156874235
4-[4-[5-[bromo(triphenyl)-λ5-phosphanyl]pentoxy]phenyl]-6-N,6-N-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine (PubChem CID 156874235) has the molecular formula C34H39BrN5OP and a molecular weight of 644.60 g/mol. Its IUPAC name is 4-[4-[5-[bromo(triphenyl)-λ5-phosphanyl]pentoxy]phenyl]-6-N,6-N-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine.
| Compound Name | 4-[4-[5-[bromo(triphenyl)-λ5-phosphanyl]pentoxy]phenyl]-6-N,6-N-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
|---|---|
| PubChem CID | 156874235 |
| Molecular Formula | C34H39BrN5OP |
| Molecular Weight | 644.60 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | 4-[4-[5-[bromo(triphenyl)-λ5-phosphanyl]pentoxy]phenyl]-6-N,6-N-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
| SMILES | CN(C)C1=NC(c2ccc(OCCCCCP(Br)(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)N=C(N)N1 |
| InChI | InChI=1S/C34H39BrN5OP/c1-40(2)34-38-32(37-33(36)39-34)27-21-23-28(24-22-27)41-25-13-6-14-26-42(35,29-15-7-3-8-16-29,30-17-9-4-10-18-30)31-19-11-5-12-20-31/h3-5,7-12,15-24,32H,6,13-14,25-26H2,1-2H3,(H3,36,37,38,39) |
| InChIKey | MCYUKASPGCOBSK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|