C14H24N2OS — CID 156877865
1-methyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]sulfinyl-1,4-diazepane (PubChem CID 156877865) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 1-methyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]sulfinyl-1,4-diazepane.
| Compound Name | 1-methyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]sulfinyl-1,4-diazepane |
|---|---|
| PubChem CID | 156877865 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-methyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]sulfinyl-1,4-diazepane |
| SMILES | C=C/C(C)=C\C=C(/C)S(=O)N1CCCN(C)CC1 |
| InChI | InChI=1S/C14H24N2OS/c1-5-13(2)7-8-14(3)18(17)16-10-6-9-15(4)11-12-16/h5,7-8H,1,6,9-12H2,2-4H3/b13-7-,14-8+ |
| InChIKey | FCTMIEDITMKPNE-MFUUIURDSA-N |
| XLogP | 2.32 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|