C12H18BrNOS — CID 144712757
1-[(2E,4E)-5-bromo-2-ethenylhexa-2,4-dienyl]sulfinylpyrrolidine (PubChem CID 144712757) has the molecular formula C12H18BrNOS and a molecular weight of 304.25 g/mol. Its IUPAC name is 1-[(2E,4E)-5-bromo-2-ethenylhexa-2,4-dienyl]sulfinylpyrrolidine.
| Compound Name | 1-[(2E,4E)-5-bromo-2-ethenylhexa-2,4-dienyl]sulfinylpyrrolidine |
|---|---|
| PubChem CID | 144712757 |
| Molecular Formula | C12H18BrNOS |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 1-[(2E,4E)-5-bromo-2-ethenylhexa-2,4-dienyl]sulfinylpyrrolidine |
| SMILES | C=C/C(=C\C=C(/C)Br)CS(=O)N1CCCC1 |
| InChI | InChI=1S/C12H18BrNOS/c1-3-12(7-6-11(2)13)10-16(15)14-8-4-5-9-14/h3,6-7H,1,4-5,8-10H2,2H3/b11-6+,12-7+ |
| InChIKey | LWEVTHVUWACLGB-GNXRPPCSSA-N |
| XLogP | 3.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|