C13H24N4 — CID 134406811
[(Z)-but-2-en-2-yl]-[1-(4-methyl-1,4-diazepan-1-yl)prop-2-enyl]diazene (PubChem CID 134406811) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is [(Z)-but-2-en-2-yl]-[1-(4-methyl-1,4-diazepan-1-yl)prop-2-enyl]diazene.
| Compound Name | [(Z)-but-2-en-2-yl]-[1-(4-methyl-1,4-diazepan-1-yl)prop-2-enyl]diazene |
|---|---|
| PubChem CID | 134406811 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | [(Z)-but-2-en-2-yl]-[1-(4-methyl-1,4-diazepan-1-yl)prop-2-enyl]diazene |
| SMILES | C=CC(/N=N/C(C)=C\C)N1CCCN(C)CC1 |
| InChI | InChI=1S/C13H24N4/c1-5-12(3)14-15-13(6-2)17-9-7-8-16(4)10-11-17/h5-6,13H,2,7-11H2,1,3-4H3/b12-5-,15-14+ |
| InChIKey | DQMNIFYBIYYOAG-PDLDLSOBSA-N |
| XLogP | 2.51 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|