C25H21FN4O7 — CID 156903886
(3S)-3-[6-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]oxy-2,2-dimethyl-3,4-dihydropyrano[3,2-g]chromen-8-one (PubChem CID 156903886) has the molecular formula C25H21FN4O7 and a molecular weight of 508.46 g/mol. Its IUPAC name is (3S)-3-[6-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]oxy-2,2-dimethyl-3,4-dihydropyrano[3,2-g]chromen-8-one.
| Compound Name | (3S)-3-[6-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]oxy-2,2-dimethyl-3,4-dihydropyrano[3,2-g]chromen-8-one |
|---|---|
| PubChem CID | 156903886 |
| Molecular Formula | C25H21FN4O7 |
| Molecular Weight | 508.46 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | (3S)-3-[6-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]oxy-2,2-dimethyl-3,4-dihydropyrano[3,2-g]chromen-8-one |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1Nc1cc(O[C@H]2Cc3cc4ccc(=O)oc4cc3OC2(C)C)ncn1 |
| InChI | InChI=1S/C25H21FN4O7/c1-25(2)21(7-14-6-13-4-5-24(31)35-18(13)10-19(14)37-25)36-23-11-22(27-12-28-23)29-16-9-17(30(32)33)15(26)8-20(16)34-3/h4-6,8-12,21H,7H2,1-3H3,(H,27,28,29)/t21-/m0/s1 |
| InChIKey | PTOGWBWHTXECJS-NRFANRHFSA-N |
| XLogP | 4.54 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|