C18H23N2W- — CID 157055981
ethane;7-methyl-5-methylidene-3-phenyl-1,4,6,8-tetrahydrocinnolin-7-ide;tungsten (PubChem CID 157055981) has the molecular formula C18H23N2W- and a molecular weight of 451.24 g/mol. Its IUPAC name is ethane;7-methyl-5-methylidene-3-phenyl-1,4,6,8-tetrahydrocinnolin-7-ide;tungsten.
| Compound Name | ethane;7-methyl-5-methylidene-3-phenyl-1,4,6,8-tetrahydrocinnolin-7-ide;tungsten |
|---|---|
| PubChem CID | 157055981 |
| Molecular Formula | C18H23N2W- |
| Molecular Weight | 451.24 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | ethane;7-methyl-5-methylidene-3-phenyl-1,4,6,8-tetrahydrocinnolin-7-ide;tungsten |
| SMILES | C=C1C[C-](C)CC2=C1CC(c1ccccc1)=NN2.CC.[W] |
| InChI | InChI=1S/C16H17N2.C2H6.W/c1-11-8-12(2)14-10-15(17-18-16(14)9-11)13-6-4-3-5-7-13;1-2;/h3-7,18H,2,8-10H2,1H3;1-2H3;/q-1;; |
| InChIKey | XASFVQDVJHWCNH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.24 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|