C19H19ClF3N3O5S — CID 157094610
N-[(2-chloro-3-nitrophenyl)methyl]-N-[2-(1,1-dioxothiolan-3-yl)ethyl]-5-(trifluoromethyl)-2H-pyrrole-3-carboxamide (PubChem CID 157094610) has the molecular formula C19H19ClF3N3O5S and a molecular weight of 493.89 g/mol. Its IUPAC name is N-[(2-chloro-3-nitrophenyl)methyl]-N-[2-(1,1-dioxothiolan-3-yl)ethyl]-5-(trifluoromethyl)-2H-pyrrole-3-carboxamide.
| Compound Name | N-[(2-chloro-3-nitrophenyl)methyl]-N-[2-(1,1-dioxothiolan-3-yl)ethyl]-5-(trifluoromethyl)-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 157094610 |
| Molecular Formula | C19H19ClF3N3O5S |
| Molecular Weight | 493.89 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | N-[(2-chloro-3-nitrophenyl)methyl]-N-[2-(1,1-dioxothiolan-3-yl)ethyl]-5-(trifluoromethyl)-2H-pyrrole-3-carboxamide |
| SMILES | O=C(C1=CC(C(F)(F)F)=NC1)N(CCC1CCS(=O)(=O)C1)Cc1cccc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C19H19ClF3N3O5S/c20-17-13(2-1-3-15(17)26(28)29)10-25(6-4-12-5-7-32(30,31)11-12)18(27)14-8-16(24-9-14)19(21,22)23/h1-3,8,12H,4-7,9-11H2 |
| InChIKey | UTWXWGYTXDCVFJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 109.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.89 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|