C12H13ClN2O5S — CID 7222854
N-(4-chloro-3-nitrophenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 7222854) has the molecular formula C12H13ClN2O5S and a molecular weight of 332.77 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 7222854 |
| Molecular Formula | C12H13ClN2O5S |
| Molecular Weight | 332.77 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | O=C(C[C@@H]1CCS(=O)(=O)C1)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H13ClN2O5S/c13-10-2-1-9(6-11(10)15(17)18)14-12(16)5-8-3-4-21(19,20)7-8/h1-2,6,8H,3-5,7H2,(H,14,16)/t8-/m0/s1 |
| InChIKey | CZXAEGQKAKFIJU-QMMMGPOBSA-N |
| XLogP | 2.01 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.77 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|