C33H38F2O5S2 — CID 157095171
2-(4-butan-2-ylbenzoyl)oxy-1,1-difluoroethanesulfonate;methane;triphenylsulfanium (PubChem CID 157095171) has the molecular formula C33H38F2O5S2 and a molecular weight of 616.79 g/mol. Its IUPAC name is 2-(4-butan-2-ylbenzoyl)oxy-1,1-difluoroethanesulfonate;methane;triphenylsulfanium.
| Compound Name | 2-(4-butan-2-ylbenzoyl)oxy-1,1-difluoroethanesulfonate;methane;triphenylsulfanium |
|---|---|
| PubChem CID | 157095171 |
| Molecular Formula | C33H38F2O5S2 |
| Molecular Weight | 616.79 g/mol |
| Exact Mass | 616.21 |
| IUPAC Name | 2-(4-butan-2-ylbenzoyl)oxy-1,1-difluoroethanesulfonate;methane;triphenylsulfanium |
| SMILES | C.C.CCC(C)c1ccc(C(=O)OCC(F)(F)S(=O)(=O)[O-])cc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C13H16F2O5S.2CH4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-9(2)10-4-6-11(7-5-10)12(16)20-8-13(14,15)21(17,18)19;;/h1-15H;4-7,9H,3,8H2,1-2H3,(H,17,18,19);2*1H4/q+1;;;/p-1 |
| InChIKey | AFCWYVMEGVUWJX-UHFFFAOYSA-M |
| XLogP | 8.55 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.79 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|