C44H53N4O3S+ — CID 157136045
3-[2-[(E,3Z)-1,2-dicyano-3-[3,3-dibutyl-1-(6-hydroxyhexyl)indol-2-ylidene]prop-1-enyl]-3-methyl-3-(thiophen-2-ylmethyl)indol-1-ium-1-yl]propanoic acid (PubChem CID 157136045) has the molecular formula C44H53N4O3S+ and a molecular weight of 718.00 g/mol. Its IUPAC name is 3-[2-[(E,3Z)-1,2-dicyano-3-[3,3-dibutyl-1-(6-hydroxyhexyl)indol-2-ylidene]prop-1-enyl]-3-methyl-3-(thiophen-2-ylmethyl)indol-1-ium-1-yl]propanoic acid.
| Compound Name | 3-[2-[(E,3Z)-1,2-dicyano-3-[3,3-dibutyl-1-(6-hydroxyhexyl)indol-2-ylidene]prop-1-enyl]-3-methyl-3-(thiophen-2-ylmethyl)indol-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 157136045 |
| Molecular Formula | C44H53N4O3S+ |
| Molecular Weight | 718.00 g/mol |
| Exact Mass | 717.38 |
| IUPAC Name | 3-[2-[(E,3Z)-1,2-dicyano-3-[3,3-dibutyl-1-(6-hydroxyhexyl)indol-2-ylidene]prop-1-enyl]-3-methyl-3-(thiophen-2-ylmethyl)indol-1-ium-1-yl]propanoic acid |
| SMILES | CCCCC1(CCCC)/C(=C/C(C#N)=C(\C#N)C2=[N+](CCC(=O)O)c3ccccc3C2(C)Cc2cccs2)N(CCCCCCO)c2ccccc21 |
| InChI | InChI=1S/C44H52N4O3S/c1-4-6-23-44(24-7-5-2)37-19-11-13-21-39(37)47(25-14-8-9-15-27-49)40(44)29-33(31-45)35(32-46)42-43(3,30-34-17-16-28-52-34)36-18-10-12-20-38(36)48(42)26-22-41(50)51/h10-13,16-21,28-29,49H,4-9,14-15,22-27,30H2,1-3H3/p+1 |
| InChIKey | BCDRCHNRCIGNGM-UHFFFAOYSA-O |
| XLogP | 9.74 |
| TPSA | 111.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.00 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|