C13H26Ar2N2 — CID 157147348
argon;3,4-dimethylhexane;3,5-dimethyl-4H-pyrazole (PubChem CID 157147348) has the molecular formula C13H26Ar2N2 and a molecular weight of 290.26 g/mol. Its IUPAC name is argon;3,4-dimethylhexane;3,5-dimethyl-4H-pyrazole.
| Compound Name | argon;3,4-dimethylhexane;3,5-dimethyl-4H-pyrazole |
|---|---|
| PubChem CID | 157147348 |
| Molecular Formula | C13H26Ar2N2 |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | argon;3,4-dimethylhexane;3,5-dimethyl-4H-pyrazole |
| SMILES | CC1=NN=C(C)C1.CCC(C)C(C)CC.[Ar].[Ar] |
| InChI | InChI=1S/C8H18.C5H8N2.2Ar/c1-5-7(3)8(4)6-2;1-4-3-5(2)7-6-4;;/h7-8H,5-6H2,1-4H3;3H2,1-2H3;; |
| InChIKey | AKVYQXDBNJWNQS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |