C31H42N4O5S — CID 157152100
5-[(2R,3S)-3-amino-2-hydroxy-4-thiophen-2-ylbutyl]-5-N-[(3-methoxyphenyl)methyl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide (PubChem CID 157152100) has the molecular formula C31H42N4O5S and a molecular weight of 582.77 g/mol. Its IUPAC name is 5-[(2R,3S)-3-amino-2-hydroxy-4-thiophen-2-ylbutyl]-5-N-[(3-methoxyphenyl)methyl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide.
| Compound Name | 5-[(2R,3S)-3-amino-2-hydroxy-4-thiophen-2-ylbutyl]-5-N-[(3-methoxyphenyl)methyl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 157152100 |
| Molecular Formula | C31H42N4O5S |
| Molecular Weight | 582.77 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | 5-[(2R,3S)-3-amino-2-hydroxy-4-thiophen-2-ylbutyl]-5-N-[(3-methoxyphenyl)methyl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide |
| SMILES | CCCN(CCC)C(=O)C1=CC(C(N)=O)=CC(C[C@@H](O)[C@@H](N)Cc2cccs2)(C(=O)NCc2cccc(OC)c2)C1 |
| InChI | InChI=1S/C31H42N4O5S/c1-4-11-35(12-5-2)29(38)23-15-22(28(33)37)17-31(18-23,19-27(36)26(32)16-25-10-7-13-41-25)30(39)34-20-21-8-6-9-24(14-21)40-3/h6-10,13-15,17,26-27,36H,4-5,11-12,16,18-20,32H2,1-3H3,(H2,33,37)(H,34,39)/t26-,27+,31?/m0/s1 |
| InChIKey | ALJKXKYCZIJFGF-VIHOQOLSSA-N |
| XLogP | 3.07 |
| TPSA | 147.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.77 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |