C34H46N4O5 — CID 159644858
5-[(2R,3S)-3-amino-2-hydroxy-4-(3-methylphenyl)butyl]-5-N-[(3-methoxyphenyl)methyl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide (PubChem CID 159644858) has the molecular formula C34H46N4O5 and a molecular weight of 590.77 g/mol. Its IUPAC name is 5-[(2R,3S)-3-amino-2-hydroxy-4-(3-methylphenyl)butyl]-5-N-[(3-methoxyphenyl)methyl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide.
| Compound Name | 5-[(2R,3S)-3-amino-2-hydroxy-4-(3-methylphenyl)butyl]-5-N-[(3-methoxyphenyl)methyl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 159644858 |
| Molecular Formula | C34H46N4O5 |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 590.35 |
| IUPAC Name | 5-[(2R,3S)-3-amino-2-hydroxy-4-(3-methylphenyl)butyl]-5-N-[(3-methoxyphenyl)methyl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide |
| SMILES | CCCN(CCC)C(=O)C1=CC(C(N)=O)=CC(C[C@@H](O)[C@@H](N)Cc2cccc(C)c2)(C(=O)NCc2cccc(OC)c2)C1 |
| InChI | InChI=1S/C34H46N4O5/c1-5-13-38(14-6-2)32(41)27-18-26(31(36)40)19-34(20-27,33(42)37-22-25-11-8-12-28(16-25)43-4)21-30(39)29(35)17-24-10-7-9-23(3)15-24/h7-12,15-16,18-19,29-30,39H,5-6,13-14,17,20-22,35H2,1-4H3,(H2,36,40)(H,37,42)/t29-,30+,34?/m0/s1 |
| InChIKey | MQVBYQPLRXLRJN-NKLTVWTFSA-N |
| XLogP | 3.32 |
| TPSA | 147.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |