C31H45F3N4O5 — CID 152657229
5-[(2R,3S)-3-amino-2-hydroxy-4-[3-(trifluoromethoxy)phenyl]butyl]-5-N-(3-methylbutyl)-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide (PubChem CID 152657229) has the molecular formula C31H45F3N4O5 and a molecular weight of 610.72 g/mol. Its IUPAC name is 5-[(2R,3S)-3-amino-2-hydroxy-4-[3-(trifluoromethoxy)phenyl]butyl]-5-N-(3-methylbutyl)-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide.
| Compound Name | 5-[(2R,3S)-3-amino-2-hydroxy-4-[3-(trifluoromethoxy)phenyl]butyl]-5-N-(3-methylbutyl)-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 152657229 |
| Molecular Formula | C31H45F3N4O5 |
| Molecular Weight | 610.72 g/mol |
| Exact Mass | 610.33 |
| IUPAC Name | 5-[(2R,3S)-3-amino-2-hydroxy-4-[3-(trifluoromethoxy)phenyl]butyl]-5-N-(3-methylbutyl)-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide |
| SMILES | CCCN(CCC)C(=O)C1=CC(C(N)=O)=CC(C[C@@H](O)[C@@H](N)Cc2cccc(OC(F)(F)F)c2)(C(=O)NCCC(C)C)C1 |
| InChI | InChI=1S/C31H45F3N4O5/c1-5-12-38(13-6-2)28(41)23-16-22(27(36)40)17-30(18-23,29(42)37-11-10-20(3)4)19-26(39)25(35)15-21-8-7-9-24(14-21)43-31(32,33)34/h7-9,14,16-17,20,25-26,39H,5-6,10-13,15,18-19,35H2,1-4H3,(H2,36,40)(H,37,42)/t25-,26+,30?/m0/s1 |
| InChIKey | ZITVEKGKLTYEJA-RSWNPTKKSA-N |
| XLogP | 3.75 |
| TPSA | 147.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.72 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |