C31H48N4O5 — CID 151684242
5-[(2S,3R)-3-hydroxy-1-(4-methoxyphenyl)-4-(3-methylbutylamino)butan-2-yl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide (PubChem CID 151684242) has the molecular formula C31H48N4O5 and a molecular weight of 556.75 g/mol. Its IUPAC name is 5-[(2S,3R)-3-hydroxy-1-(4-methoxyphenyl)-4-(3-methylbutylamino)butan-2-yl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide.
| Compound Name | 5-[(2S,3R)-3-hydroxy-1-(4-methoxyphenyl)-4-(3-methylbutylamino)butan-2-yl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 151684242 |
| Molecular Formula | C31H48N4O5 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.36 |
| IUPAC Name | 5-[(2S,3R)-3-hydroxy-1-(4-methoxyphenyl)-4-(3-methylbutylamino)butan-2-yl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide |
| SMILES | CCCN(CCC)C(=O)C1=CC(C(N)=O)=CC(C(N)=O)([C@H](Cc2ccc(OC)cc2)[C@@H](O)CNCCC(C)C)C1 |
| InChI | InChI=1S/C31H48N4O5/c1-6-14-35(15-7-2)29(38)24-17-23(28(32)37)18-31(19-24,30(33)39)26(27(36)20-34-13-12-21(3)4)16-22-8-10-25(40-5)11-9-22/h8-11,17-18,21,26-27,34,36H,6-7,12-16,19-20H2,1-5H3,(H2,32,37)(H2,33,39)/t26-,27+,31?/m1/s1 |
| InChIKey | RBEQNIZPAQHRAP-SCSQSSOESA-N |
| XLogP | 2.71 |
| TPSA | 147.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|