C34H46N4O6 — CID 158540154
5-[(2R,3S)-3-amino-2-hydroxy-4-(4-methoxyphenyl)butyl]-5-N-[(3-methoxyphenyl)methyl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide (PubChem CID 158540154) has the molecular formula C34H46N4O6 and a molecular weight of 606.76 g/mol. Its IUPAC name is 5-[(2R,3S)-3-amino-2-hydroxy-4-(4-methoxyphenyl)butyl]-5-N-[(3-methoxyphenyl)methyl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide.
| Compound Name | 5-[(2R,3S)-3-amino-2-hydroxy-4-(4-methoxyphenyl)butyl]-5-N-[(3-methoxyphenyl)methyl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 158540154 |
| Molecular Formula | C34H46N4O6 |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.34 |
| IUPAC Name | 5-[(2R,3S)-3-amino-2-hydroxy-4-(4-methoxyphenyl)butyl]-5-N-[(3-methoxyphenyl)methyl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide |
| SMILES | CCCN(CCC)C(=O)C1=CC(C(N)=O)=CC(C[C@@H](O)[C@@H](N)Cc2ccc(OC)cc2)(C(=O)NCc2cccc(OC)c2)C1 |
| InChI | InChI=1S/C34H46N4O6/c1-5-14-38(15-6-2)32(41)26-18-25(31(36)40)19-34(20-26,33(42)37-22-24-8-7-9-28(16-24)44-4)21-30(39)29(35)17-23-10-12-27(43-3)13-11-23/h7-13,16,18-19,29-30,39H,5-6,14-15,17,20-22,35H2,1-4H3,(H2,36,40)(H,37,42)/t29-,30+,34?/m0/s1 |
| InChIKey | HOKNEAPXXQAPDH-NKLTVWTFSA-N |
| XLogP | 3.02 |
| TPSA | 157.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |