C14H29N3O11P2 — CID 157180874
aminomethoxy(methyl)phosphinic acid;(2,5-dioxopyrrolidin-1-yl) propanoate;methyl-[(propanoylamino)methoxy]phosphinic acid (PubChem CID 157180874) has the molecular formula C14H29N3O11P2 and a molecular weight of 477.34 g/mol. Its IUPAC name is aminomethoxy(methyl)phosphinic acid;(2,5-dioxopyrrolidin-1-yl) propanoate;methyl-[(propanoylamino)methoxy]phosphinic acid.
| Compound Name | aminomethoxy(methyl)phosphinic acid;(2,5-dioxopyrrolidin-1-yl) propanoate;methyl-[(propanoylamino)methoxy]phosphinic acid |
|---|---|
| PubChem CID | 157180874 |
| Molecular Formula | C14H29N3O11P2 |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | aminomethoxy(methyl)phosphinic acid;(2,5-dioxopyrrolidin-1-yl) propanoate;methyl-[(propanoylamino)methoxy]phosphinic acid |
| SMILES | CCC(=O)NCOP(C)(=O)O.CCC(=O)ON1C(=O)CCC1=O.CP(=O)(O)OCN |
| InChI | InChI=1S/C7H9NO4.C5H12NO4P.C2H8NO3P/c1-2-7(11)12-8-5(9)3-4-6(8)10;1-3-5(7)6-4-10-11(2,8)9;1-7(4,5)6-2-3/h2-4H2,1H3;3-4H2,1-2H3,(H,6,7)(H,8,9);2-3H2,1H3,(H,4,5) |
| InChIKey | AOOAVFAHXDZARC-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 211.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|