C18H34O2Si3 — CID 157191653
[dimethyl(2-phenylbutyl)silyl]oxy-ethenyl-methyl-trimethylsilyloxysilane (PubChem CID 157191653) has the molecular formula C18H34O2Si3 and a molecular weight of 366.73 g/mol. Its IUPAC name is [dimethyl(2-phenylbutyl)silyl]oxy-ethenyl-methyl-trimethylsilyloxysilane.
| Compound Name | [dimethyl(2-phenylbutyl)silyl]oxy-ethenyl-methyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 157191653 |
| Molecular Formula | C18H34O2Si3 |
| Molecular Weight | 366.73 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | [dimethyl(2-phenylbutyl)silyl]oxy-ethenyl-methyl-trimethylsilyloxysilane |
| SMILES | C=C[Si](C)(O[Si](C)(C)C)O[Si](C)(C)CC(CC)c1ccccc1 |
| InChI | InChI=1S/C18H34O2Si3/c1-9-17(18-14-12-11-13-15-18)16-22(6,7)20-23(8,10-2)19-21(3,4)5/h10-15,17H,2,9,16H2,1,3-8H3 |
| InChIKey | ZQPWVTWOSDNYON-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.73 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|