C29H34O9 — CID 157346246
4,5-dimethylbenzene-1,3-diol;4-methylbenzene-1,3-diol;5-methylbenzene-1,3-diol;2-methylbenzene-1,3,5-triol (PubChem CID 157346246) has the molecular formula C29H34O9 and a molecular weight of 526.58 g/mol. Its IUPAC name is 4,5-dimethylbenzene-1,3-diol;4-methylbenzene-1,3-diol;5-methylbenzene-1,3-diol;2-methylbenzene-1,3,5-triol.
| Compound Name | 4,5-dimethylbenzene-1,3-diol;4-methylbenzene-1,3-diol;5-methylbenzene-1,3-diol;2-methylbenzene-1,3,5-triol |
|---|---|
| PubChem CID | 157346246 |
| Molecular Formula | C29H34O9 |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 4,5-dimethylbenzene-1,3-diol;4-methylbenzene-1,3-diol;5-methylbenzene-1,3-diol;2-methylbenzene-1,3,5-triol |
| SMILES | Cc1c(O)cc(O)cc1O.Cc1cc(O)cc(O)c1.Cc1cc(O)cc(O)c1C.Cc1ccc(O)cc1O |
| InChI | InChI=1S/C8H10O2.C7H8O3.2C7H8O2/c1-5-3-7(9)4-8(10)6(5)2;1-4-6(9)2-5(8)3-7(4)10;1-5-2-6(8)4-7(9)3-5;1-5-2-3-6(8)4-7(5)9/h3-4,9-10H,1-2H3;2-3,8-10H,1H3;2*2-4,8-9H,1H3 |
| InChIKey | BGZSJGAHTPTHJD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 182.07 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |