C26H25ClN2O6 — CID 157393981
5-chloro-2-(2,4-dioxocyclohexyl)-4-[[4-(morpholin-4-ylmethyl)phenyl]methoxy]isoindole-1,3-dione (PubChem CID 157393981) has the molecular formula C26H25ClN2O6 and a molecular weight of 496.95 g/mol. Its IUPAC name is 5-chloro-2-(2,4-dioxocyclohexyl)-4-[[4-(morpholin-4-ylmethyl)phenyl]methoxy]isoindole-1,3-dione.
| Compound Name | 5-chloro-2-(2,4-dioxocyclohexyl)-4-[[4-(morpholin-4-ylmethyl)phenyl]methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 157393981 |
| Molecular Formula | C26H25ClN2O6 |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 5-chloro-2-(2,4-dioxocyclohexyl)-4-[[4-(morpholin-4-ylmethyl)phenyl]methoxy]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(Cl)c(OCc4ccc(CN5CCOCC5)cc4)c3C2=O)C(=O)C1 |
| InChI | InChI=1S/C26H25ClN2O6/c27-20-7-6-19-23(26(33)29(25(19)32)21-8-5-18(30)13-22(21)31)24(20)35-15-17-3-1-16(2-4-17)14-28-9-11-34-12-10-28/h1-4,6-7,21H,5,8-15H2 |
| InChIKey | MHBXGNPDUKGTAK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|