C26H42N8O4 — CID 157408539
2-(dimethylcarbamoyl)-5-ethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carbonyl azide;5-ethyl-5-isocyanato-N,N-dimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide (PubChem CID 157408539) has the molecular formula C26H42N8O4 and a molecular weight of 530.67 g/mol. Its IUPAC name is 2-(dimethylcarbamoyl)-5-ethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carbonyl azide;5-ethyl-5-isocyanato-N,N-dimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | 2-(dimethylcarbamoyl)-5-ethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carbonyl azide;5-ethyl-5-isocyanato-N,N-dimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 157408539 |
| Molecular Formula | C26H42N8O4 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | 2-(dimethylcarbamoyl)-5-ethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carbonyl azide;5-ethyl-5-isocyanato-N,N-dimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
| SMILES | CCC1(C(=O)N=[N+]=[N-])CC2CN(C(=O)N(C)C)CC2C1.CCC1(N=C=O)CC2CN(C(=O)N(C)C)CC2C1 |
| InChI | InChI=1S/C13H21N5O2.C13H21N3O2/c1-4-13(11(19)15-16-14)5-9-7-18(8-10(9)6-13)12(20)17(2)3;1-4-13(14-9-17)5-10-7-16(8-11(10)6-13)12(18)15(2)3/h9-10H,4-8H2,1-3H3;10-11H,4-8H2,1-3H3 |
| InChIKey | BNZWLRWRHZWJMW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 142.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|