About methanamine;naphthalene;triethyl(4-oxopentyl)azanium
methanamine;naphthalene;triethyl(4-oxopentyl)azanium (PubChem CID 157435491) has the molecular formula C22H37N2O+
and a molecular weight of 345.55 g/mol. Its IUPAC name is methanamine;naphthalene;triethyl(4-oxopentyl)azanium.
Molecular Properties
| Compound Name | methanamine;naphthalene;triethyl(4-oxopentyl)azanium |
| PubChem CID | 157435491 |
| Molecular Formula | C22H37N2O+ |
| Molecular Weight | 345.55 g/mol |
| Exact Mass | 345.29 |
| IUPAC Name | methanamine;naphthalene;triethyl(4-oxopentyl)azanium |
| SMILES | CC[N+](CC)(CC)CCCC(C)=O.CN.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H24NO.C10H8.CH5N/c1-5-12(6-2,7-3)10-8-9-11(4)13;1-2-6-10-8-4-3-7-9(10)5-1;1-2/h5-10H2,1-4H3;1-8H;2H2,1H3/q+1;; |
| InChIKey | WTXIIRGZWHODCB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze methanamine;naphthalene;triethyl(4-oxopentyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;naphthalene;triethyl(4-oxopentyl)azanium?
The IUPAC name of methanamine;naphthalene;triethyl(4-oxopentyl)azanium (CID 157435491) is methanamine;naphthalene;triethyl(4-oxopentyl)azanium.
What is the SMILES notation for methanamine;naphthalene;triethyl(4-oxopentyl)azanium?
The canonical SMILES for methanamine;naphthalene;triethyl(4-oxopentyl)azanium is CC[N+](CC)(CC)CCCC(C)=O.CN.c1ccc2ccccc2c1.
What is the InChIKey of methanamine;naphthalene;triethyl(4-oxopentyl)azanium?
The InChIKey is WTXIIRGZWHODCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24NO.C10H8.CH5N/c1-5-12(6-2,7-3)10-8-9-11(4)13;1-2-6-10-8-4-3-7-9(10)5-1;1-2/h5-10H2,1-4H3;1-8H;2H2,1H3/q+1;;.
What are the key properties of methanamine;naphthalene;triethyl(4-oxopentyl)azanium?
methanamine;naphthalene;triethyl(4-oxopentyl)azanium has a molecular weight of 345.55 g/mol, XLogP of 4.65, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;naphthalene;triethyl(4-oxopentyl)azanium is sourced from PubChem (CID 157435491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).