C37H45F2O8S2+ — CID 157476748
(4-cyclohexylphenyl)-[4-[2-(2,2-difluoro-2-sulfoethoxy)acetyl]oxy-3,5-dimethylphenyl]-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfanium (PubChem CID 157476748) has the molecular formula C37H45F2O8S2+ and a molecular weight of 719.89 g/mol. Its IUPAC name is (4-cyclohexylphenyl)-[4-[2-(2,2-difluoro-2-sulfoethoxy)acetyl]oxy-3,5-dimethylphenyl]-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfanium.
| Compound Name | (4-cyclohexylphenyl)-[4-[2-(2,2-difluoro-2-sulfoethoxy)acetyl]oxy-3,5-dimethylphenyl]-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfanium |
|---|---|
| PubChem CID | 157476748 |
| Molecular Formula | C37H45F2O8S2+ |
| Molecular Weight | 719.89 g/mol |
| Exact Mass | 719.25 |
| IUPAC Name | (4-cyclohexylphenyl)-[4-[2-(2,2-difluoro-2-sulfoethoxy)acetyl]oxy-3,5-dimethylphenyl]-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfanium |
| SMILES | Cc1cc([S+](c2ccc(C3CCCCC3)cc2)c2ccc(C3(C)OCC(C)(C)CO3)cc2)cc(C)c1OC(=O)COCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C37H44F2O8S2/c1-25-19-32(20-26(2)34(25)47-33(40)21-44-24-37(38,39)49(41,42)43)48(30-15-11-28(12-16-30)27-9-7-6-8-10-27)31-17-13-29(14-18-31)36(5)45-22-35(3,4)23-46-36/h11-20,27H,6-10,21-24H2,1-5H3/p+1 |
| InChIKey | JLKCLHMVDVWABF-UHFFFAOYSA-O |
| XLogP | 8.09 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.89 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|