C16H23BN2O3 — CID 157485296
4-(4-amino-2,6-dimethylphenyl)-3,5-dimethylaniline;boric acid (PubChem CID 157485296) has the molecular formula C16H23BN2O3 and a molecular weight of 302.18 g/mol. Its IUPAC name is 4-(4-amino-2,6-dimethylphenyl)-3,5-dimethylaniline;boric acid.
| Compound Name | 4-(4-amino-2,6-dimethylphenyl)-3,5-dimethylaniline;boric acid |
|---|---|
| PubChem CID | 157485296 |
| Molecular Formula | C16H23BN2O3 |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 4-(4-amino-2,6-dimethylphenyl)-3,5-dimethylaniline;boric acid |
| SMILES | Cc1cc(N)cc(C)c1-c1c(C)cc(N)cc1C.OB(O)O |
| InChI | InChI=1S/C16H20N2.BH3O3/c1-9-5-13(17)6-10(2)15(9)16-11(3)7-14(18)8-12(16)4;2-1(3)4/h5-8H,17-18H2,1-4H3;2-4H |
| InChIKey | BWQJQUGNVPLDIH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|