About diazanium;but-2-enedioate;chloroethene
diazanium;but-2-enedioate;chloroethene (PubChem CID 157489685) has the molecular formula C6H13ClN2O4
and a molecular weight of 212.63 g/mol. Its IUPAC name is diazanium;but-2-enedioate;chloroethene.
Molecular Properties
| Compound Name | diazanium;but-2-enedioate;chloroethene |
| PubChem CID | 157489685 |
| Molecular Formula | C6H13ClN2O4 |
| Molecular Weight | 212.63 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | diazanium;but-2-enedioate;chloroethene |
| SMILES | C=CCl.O=C([O-])C=CC(=O)[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C4H4O4.C2H3Cl.2H3N/c5-3(6)1-2-4(7)8;1-2-3;;/h1-2H,(H,5,6)(H,7,8);2H,1H2;2*1H3 |
| InChIKey | BXCVXIMNFFIUSG-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 153.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.63 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diazanium;but-2-enedioate;chloroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;but-2-enedioate;chloroethene?
The IUPAC name of diazanium;but-2-enedioate;chloroethene (CID 157489685) is diazanium;but-2-enedioate;chloroethene.
What is the SMILES notation for diazanium;but-2-enedioate;chloroethene?
The canonical SMILES for diazanium;but-2-enedioate;chloroethene is C=CCl.O=C([O-])C=CC(=O)[O-].[NH4+].[NH4+].
What is the InChIKey of diazanium;but-2-enedioate;chloroethene?
The InChIKey is BXCVXIMNFFIUSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4O4.C2H3Cl.2H3N/c5-3(6)1-2-4(7)8;1-2-3;;/h1-2H,(H,5,6)(H,7,8);2H,1H2;2*1H3.
What are the key properties of diazanium;but-2-enedioate;chloroethene?
diazanium;but-2-enedioate;chloroethene has a molecular weight of 212.63 g/mol, XLogP of -0.84, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;but-2-enedioate;chloroethene is sourced from PubChem (CID 157489685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).