C23H44N10O10 — CID 157491089
2-amino-5-(1-aminoethylideneamino)pentanoic acid;2-(3-carboxypropanoylamino)-5-(diaminomethylideneamino)pentanoic acid;5-(diaminomethylideneamino)-2-oxopentanoic acid (PubChem CID 157491089) has the molecular formula C23H44N10O10 and a molecular weight of 620.67 g/mol. Its IUPAC name is 2-amino-5-(1-aminoethylideneamino)pentanoic acid;2-(3-carboxypropanoylamino)-5-(diaminomethylideneamino)pentanoic acid;5-(diaminomethylideneamino)-2-oxopentanoic acid.
| Compound Name | 2-amino-5-(1-aminoethylideneamino)pentanoic acid;2-(3-carboxypropanoylamino)-5-(diaminomethylideneamino)pentanoic acid;5-(diaminomethylideneamino)-2-oxopentanoic acid |
|---|---|
| PubChem CID | 157491089 |
| Molecular Formula | C23H44N10O10 |
| Molecular Weight | 620.67 g/mol |
| Exact Mass | 620.32 |
| IUPAC Name | 2-amino-5-(1-aminoethylideneamino)pentanoic acid;2-(3-carboxypropanoylamino)-5-(diaminomethylideneamino)pentanoic acid;5-(diaminomethylideneamino)-2-oxopentanoic acid |
| SMILES | C/C(N)=N\CCCC(N)C(=O)O.NC(N)=NCCCC(=O)C(=O)O.NC(N)=NCCCC(NC(=O)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H18N4O5.C7H15N3O2.C6H11N3O3/c11-10(12)13-5-1-2-6(9(18)19)14-7(15)3-4-8(16)17;1-5(8)10-4-2-3-6(9)7(11)12;7-6(8)9-3-1-2-4(10)5(11)12/h6H,1-5H2,(H,14,15)(H,16,17)(H,18,19)(H4,11,12,13);6H,2-4,9H2,1H3,(H2,8,10)(H,11,12);1-3H2,(H,11,12)(H4,7,8,9) |
| InChIKey | BXHBRKGMHBPIHS-UHFFFAOYSA-N |
| XLogP | -3.28 |
| TPSA | 388.57 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.67 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|