C15H12N2O6 — CID 15778075
[(2R,3S)-3-(2,5-dioxopyrrol-1-yl)-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl] formate (PubChem CID 15778075) has the molecular formula C15H12N2O6 and a molecular weight of 316.27 g/mol. Its IUPAC name is [(2R,3S)-3-(2,5-dioxopyrrol-1-yl)-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl] formate.
| Compound Name | [(2R,3S)-3-(2,5-dioxopyrrol-1-yl)-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl] formate |
|---|---|
| PubChem CID | 15778075 |
| Molecular Formula | C15H12N2O6 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | [(2R,3S)-3-(2,5-dioxopyrrol-1-yl)-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl] formate |
| SMILES | COc1ccc(N2C(=O)[C@@H](N3C(=O)C=CC3=O)[C@H]2OC=O)cc1 |
| InChI | InChI=1S/C15H12N2O6/c1-22-10-4-2-9(3-5-10)16-14(21)13(15(16)23-8-18)17-11(19)6-7-12(17)20/h2-8,13,15H,1H3/t13-,15-/m1/s1 |
| InChIKey | MBLYGKQTNOJYPP-UKRRQHHQSA-N |
| XLogP | -0.17 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|