C19H37N2O3P — CID 158007411
(3R,4S,6S)-5-(aminophosphanylideneamino)-4-[(2S,4S,5S)-5-[(2R)-butan-2-yl]-3,4-dimethyloxolan-2-yl]oxy-2-ethyl-3,6-dimethyloxane (PubChem CID 158007411) has the molecular formula C19H37N2O3P and a molecular weight of 372.49 g/mol. Its IUPAC name is (3R,4S,6S)-5-(aminophosphanylideneamino)-4-[(2S,4S,5S)-5-[(2R)-butan-2-yl]-3,4-dimethyloxolan-2-yl]oxy-2-ethyl-3,6-dimethyloxane.
| Compound Name | (3R,4S,6S)-5-(aminophosphanylideneamino)-4-[(2S,4S,5S)-5-[(2R)-butan-2-yl]-3,4-dimethyloxolan-2-yl]oxy-2-ethyl-3,6-dimethyloxane |
|---|---|
| PubChem CID | 158007411 |
| Molecular Formula | C19H37N2O3P |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (3R,4S,6S)-5-(aminophosphanylideneamino)-4-[(2S,4S,5S)-5-[(2R)-butan-2-yl]-3,4-dimethyloxolan-2-yl]oxy-2-ethyl-3,6-dimethyloxane |
| SMILES | CCC1O[C@@H](C)C(/N=P/N)[C@@H](O[C@@H]2O[C@@H]([C@H](C)CC)[C@@H](C)C2C)[C@@H]1C |
| InChI | InChI=1S/C19H37N2O3P/c1-8-10(3)17-11(4)12(5)19(23-17)24-18-13(6)15(9-2)22-14(7)16(18)21-25-20/h10-19H,8-9H2,1-7H3,(H2,20,21)/t10-,11+,12?,13-,14+,15?,16?,17+,18+,19+/m1/s1 |
| InChIKey | FELRLFPNQZKBMP-CKKUPWAUSA-N |
| XLogP | 4.62 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|