C22H30O5 — CID 158021403
9-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]-2,5,5-trimethylnon-1-ene-3,6-dione (PubChem CID 158021403) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is 9-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]-2,5,5-trimethylnon-1-ene-3,6-dione.
| Compound Name | 9-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]-2,5,5-trimethylnon-1-ene-3,6-dione |
|---|---|
| PubChem CID | 158021403 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 9-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]-2,5,5-trimethylnon-1-ene-3,6-dione |
| SMILES | C=C(C)C(=O)CC(C)(C)C(=O)CCCOc1ccc(C(=O)C(C)(C)O)cc1 |
| InChI | InChI=1S/C22H30O5/c1-15(2)18(23)14-21(3,4)19(24)8-7-13-27-17-11-9-16(10-12-17)20(25)22(5,6)26/h9-12,26H,1,7-8,13-14H2,2-6H3 |
| InChIKey | RLRZUQAQUBFXOR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|