C8H9BrN2 — CID 158028586
5-bromo-3-methyl-1H-pyrrolo[2,3-c]pyridine;molecular hydrogen (PubChem CID 158028586) has the molecular formula C8H9BrN2 and a molecular weight of 213.08 g/mol. Its IUPAC name is 5-bromo-3-methyl-1H-pyrrolo[2,3-c]pyridine;molecular hydrogen.
| Compound Name | 5-bromo-3-methyl-1H-pyrrolo[2,3-c]pyridine;molecular hydrogen |
|---|---|
| PubChem CID | 158028586 |
| Molecular Formula | C8H9BrN2 |
| Molecular Weight | 213.08 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 5-bromo-3-methyl-1H-pyrrolo[2,3-c]pyridine;molecular hydrogen |
| SMILES | Cc1c[nH]c2cnc(Br)cc12.[H][H] |
| InChI | InChI=1S/C8H7BrN2.H2/c1-5-3-10-7-4-11-8(9)2-6(5)7;/h2-4,10H,1H3;1H |
| InChIKey | FGXBZGIYDVKMMT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.08 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|