About potassium 4-methylsulfinylbenzoate
potassium 4-methylsulfinylbenzoate (PubChem CID 158029868) has the molecular formula C8H7KO3S
and a molecular weight of 222.31 g/mol. Its IUPAC name is potassium 4-methylsulfinylbenzoate.
Molecular Properties
| Compound Name | potassium 4-methylsulfinylbenzoate |
| PubChem CID | 158029868 |
| Molecular Formula | C8H7KO3S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | potassium 4-methylsulfinylbenzoate |
| SMILES | CS(=O)c1ccc(C(=O)[O-])cc1.[K+] |
| InChI | InChI=1S/C8H8O3S.K/c1-12(11)7-4-2-6(3-5-7)8(9)10;/h2-5H,1H3,(H,9,10);/q;+1/p-1 |
| InChIKey | FHAZAKRVQQEIQS-UHFFFAOYSA-M |
| XLogP | -3.21 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium 4-methylsulfinylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 4-methylsulfinylbenzoate?
The IUPAC name of potassium 4-methylsulfinylbenzoate (CID 158029868) is potassium 4-methylsulfinylbenzoate.
What is the SMILES notation for potassium 4-methylsulfinylbenzoate?
The canonical SMILES for potassium 4-methylsulfinylbenzoate is CS(=O)c1ccc(C(=O)[O-])cc1.[K+].
What is the InChIKey of potassium 4-methylsulfinylbenzoate?
The InChIKey is FHAZAKRVQQEIQS-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8O3S.K/c1-12(11)7-4-2-6(3-5-7)8(9)10;/h2-5H,1H3,(H,9,10);/q;+1/p-1.
What are the key properties of potassium 4-methylsulfinylbenzoate?
potassium 4-methylsulfinylbenzoate has a molecular weight of 222.31 g/mol, XLogP of -3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 4-methylsulfinylbenzoate is sourced from PubChem (CID 158029868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).