C43H48O6 — CID 158036478
(1R,2S,3S,4R,5S)-2-methyl-5-[4-methyl-3-[[4-(4-prop-2-enoxybutyl)phenyl]methyl]phenyl]-3,4-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane-1-carbaldehyde (PubChem CID 158036478) has the molecular formula C43H48O6 and a molecular weight of 660.85 g/mol. Its IUPAC name is (1R,2S,3S,4R,5S)-2-methyl-5-[4-methyl-3-[[4-(4-prop-2-enoxybutyl)phenyl]methyl]phenyl]-3,4-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane-1-carbaldehyde.
| Compound Name | (1R,2S,3S,4R,5S)-2-methyl-5-[4-methyl-3-[[4-(4-prop-2-enoxybutyl)phenyl]methyl]phenyl]-3,4-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane-1-carbaldehyde |
|---|---|
| PubChem CID | 158036478 |
| Molecular Formula | C43H48O6 |
| Molecular Weight | 660.85 g/mol |
| Exact Mass | 660.35 |
| IUPAC Name | (1R,2S,3S,4R,5S)-2-methyl-5-[4-methyl-3-[[4-(4-prop-2-enoxybutyl)phenyl]methyl]phenyl]-3,4-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane-1-carbaldehyde |
| SMILES | C=CCOCCCCc1ccc(Cc2cc([C@]34OC[C@](C=O)(O3)[C@@H](C)[C@H](OCc3ccccc3)[C@H]4OCc3ccccc3)ccc2C)cc1 |
| InChI | InChI=1S/C43H48O6/c1-4-24-45-25-12-11-13-34-19-21-35(22-20-34)26-38-27-39(23-18-32(38)2)43-41(47-29-37-16-9-6-10-17-37)40(46-28-36-14-7-5-8-15-36)33(3)42(30-44,49-43)31-48-43/h4-10,14-23,27,30,33,40-41H,1,11-13,24-26,28-29,31H2,2-3H3/t33-,40-,41+,42-,43-/m0/s1 |
| InChIKey | FHUPTQGAAGFHNS-ULHSYMOISA-N |
| XLogP | 8.07 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.85 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|