C45H49N3O7 — CID 158049795
benzyl (3R)-3-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-[(1-hydroxy-3-methoxy-3-oxo-1-phenylpropan-2-yl)amino]-4-oxobutanoate (PubChem CID 158049795) has the molecular formula C45H49N3O7 and a molecular weight of 743.90 g/mol. Its IUPAC name is benzyl (3R)-3-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-[(1-hydroxy-3-methoxy-3-oxo-1-phenylpropan-2-yl)amino]-4-oxobutanoate.
| Compound Name | benzyl (3R)-3-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-[(1-hydroxy-3-methoxy-3-oxo-1-phenylpropan-2-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 158049795 |
| Molecular Formula | C45H49N3O7 |
| Molecular Weight | 743.90 g/mol |
| Exact Mass | 743.36 |
| IUPAC Name | benzyl (3R)-3-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-[(1-hydroxy-3-methoxy-3-oxo-1-phenylpropan-2-yl)amino]-4-oxobutanoate |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(C[C@H](CC(=O)OCc4ccccc4)C(=O)NC(C(=O)OC)C(O)c4ccccc4)cc3)nc2)cc1 |
| InChI | InChI=1S/C45H49N3O7/c1-3-4-5-6-13-26-54-39-24-22-34(23-25-39)38-29-46-43(47-30-38)36-20-18-32(19-21-36)27-37(28-40(49)55-31-33-14-9-7-10-15-33)44(51)48-41(45(52)53-2)42(50)35-16-11-8-12-17-35/h7-12,14-25,29-30,37,41-42,50H,3-6,13,26-28,31H2,1-2H3,(H,48,51)/t37-,41?,42?/m1/s1 |
| InChIKey | KHUZEIFGVMJYLF-KJALYREFSA-N |
| XLogP | 7.84 |
| TPSA | 136.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.90 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|