C11H20N4O4 — CID 158090866
N-(ethylideneamino)methanamine;(Z)-4-(methylamino)-2-[2-(methylamino)-2-oxoethyl]-4-oxobut-2-enoic acid (PubChem CID 158090866) has the molecular formula C11H20N4O4 and a molecular weight of 272.31 g/mol. Its IUPAC name is N-(ethylideneamino)methanamine;(Z)-4-(methylamino)-2-[2-(methylamino)-2-oxoethyl]-4-oxobut-2-enoic acid.
| Compound Name | N-(ethylideneamino)methanamine;(Z)-4-(methylamino)-2-[2-(methylamino)-2-oxoethyl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 158090866 |
| Molecular Formula | C11H20N4O4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-(ethylideneamino)methanamine;(Z)-4-(methylamino)-2-[2-(methylamino)-2-oxoethyl]-4-oxobut-2-enoic acid |
| SMILES | CC=NNC.CNC(=O)/C=C(/CC(=O)NC)C(=O)O |
| InChI | InChI=1S/C8H12N2O4.C3H8N2/c1-9-6(11)3-5(8(13)14)4-7(12)10-2;1-3-5-4-2/h3H,4H2,1-2H3,(H,9,11)(H,10,12)(H,13,14);3-4H,1-2H3/b5-3-; |
| InChIKey | FOBUINSMEIQHJW-FBZPGIPVSA-N |
| XLogP | -0.91 |
| TPSA | 119.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|