C13H15N3 — CID 158167465
3-(2-phenylethyl)pyridine-2,4-diamine (PubChem CID 158167465) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-(2-phenylethyl)pyridine-2,4-diamine.
| Compound Name | 3-(2-phenylethyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 158167465 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 3-(2-phenylethyl)pyridine-2,4-diamine |
| SMILES | Nc1ccnc(N)c1CCc1ccccc1 |
| InChI | InChI=1S/C13H15N3/c14-12-8-9-16-13(15)11(12)7-6-10-4-2-1-3-5-10/h1-5,8-9H,6-7H2,(H4,14,15,16) |
| InChIKey | FXAHQHYKAWWPKR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |