C43H51BrN2O5P+ — CID 158172903
bromo(triphenyl)phosphanium;tert-butyl 2-ethenyl-5-ethylpyrrole-1-carboxylate;tert-butyl 2-ethyl-5-formylpyrrole-1-carboxylate (PubChem CID 158172903) has the molecular formula C43H51BrN2O5P+ and a molecular weight of 786.77 g/mol. Its IUPAC name is bromo(triphenyl)phosphanium;tert-butyl 2-ethenyl-5-ethylpyrrole-1-carboxylate;tert-butyl 2-ethyl-5-formylpyrrole-1-carboxylate.
| Compound Name | bromo(triphenyl)phosphanium;tert-butyl 2-ethenyl-5-ethylpyrrole-1-carboxylate;tert-butyl 2-ethyl-5-formylpyrrole-1-carboxylate |
|---|---|
| PubChem CID | 158172903 |
| Molecular Formula | C43H51BrN2O5P+ |
| Molecular Weight | 786.77 g/mol |
| Exact Mass | 785.27 |
| IUPAC Name | bromo(triphenyl)phosphanium;tert-butyl 2-ethenyl-5-ethylpyrrole-1-carboxylate;tert-butyl 2-ethyl-5-formylpyrrole-1-carboxylate |
| SMILES | Br[P+](c1ccccc1)(c1ccccc1)c1ccccc1.C=Cc1ccc(CC)n1C(=O)OC(C)(C)C.CCc1ccc(C=O)n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H15BrP.C13H19NO2.C12H17NO3/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-6-10-8-9-11(7-2)14(10)12(15)16-13(3,4)5;1-5-9-6-7-10(8-14)13(9)11(15)16-12(2,3)4/h1-15H;6,8-9H,1,7H2,2-5H3;6-8H,5H2,1-4H3/q+1;; |
| InChIKey | FXRDMDLCDWGRGC-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.77 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|