C22H23N3O3 — CID 178078765
tert-butyl 6-[(5-ethenylimidazol-1-yl)methyl]-2-oxo-3-phenylpyridine-1-carboxylate (PubChem CID 178078765) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is tert-butyl 6-[(5-ethenylimidazol-1-yl)methyl]-2-oxo-3-phenylpyridine-1-carboxylate.
| Compound Name | tert-butyl 6-[(5-ethenylimidazol-1-yl)methyl]-2-oxo-3-phenylpyridine-1-carboxylate |
|---|---|
| PubChem CID | 178078765 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | tert-butyl 6-[(5-ethenylimidazol-1-yl)methyl]-2-oxo-3-phenylpyridine-1-carboxylate |
| SMILES | C=Cc1cncn1Cc1ccc(-c2ccccc2)c(=O)n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H23N3O3/c1-5-17-13-23-15-24(17)14-18-11-12-19(16-9-7-6-8-10-16)20(26)25(18)21(27)28-22(2,3)4/h5-13,15H,1,14H2,2-4H3 |
| InChIKey | CSVJFLLBQIWXEA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |