C23H41N7O5 — CID 158184298
2-[3-[(2S,5S,8R,13S)-5-ethyl-8,13-dimethyl-13-(3-methyl-2-oxobutyl)-3,6,9,14-tetraoxo-1,4,7,10-tetrazacyclotetradec-2-yl]propyl]guanidine (PubChem CID 158184298) has the molecular formula C23H41N7O5 and a molecular weight of 495.63 g/mol. Its IUPAC name is 2-[3-[(2S,5S,8R,13S)-5-ethyl-8,13-dimethyl-13-(3-methyl-2-oxobutyl)-3,6,9,14-tetraoxo-1,4,7,10-tetrazacyclotetradec-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[(2S,5S,8R,13S)-5-ethyl-8,13-dimethyl-13-(3-methyl-2-oxobutyl)-3,6,9,14-tetraoxo-1,4,7,10-tetrazacyclotetradec-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 158184298 |
| Molecular Formula | C23H41N7O5 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | 2-[3-[(2S,5S,8R,13S)-5-ethyl-8,13-dimethyl-13-(3-methyl-2-oxobutyl)-3,6,9,14-tetraoxo-1,4,7,10-tetrazacyclotetradec-2-yl]propyl]guanidine |
| SMILES | CC[C@@H]1NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@](C)(CC(=O)C(C)C)CCNC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C23H41N7O5/c1-6-15-19(33)28-14(4)18(32)26-11-9-23(5,12-17(31)13(2)3)21(35)30-16(20(34)29-15)8-7-10-27-22(24)25/h13-16H,6-12H2,1-5H3,(H,26,32)(H,28,33)(H,29,34)(H,30,35)(H4,24,25,27)/t14-,15+,16+,23+/m1/s1 |
| InChIKey | FYYQUJVZAXUHSB-RADUAFRDSA-N |
| XLogP | -0.93 |
| TPSA | 197.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|